C22H18FN3O4 — CID 71565669
7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(2-fluoro-4-methoxyphenyl)quinoline-2-carboxamide (PubChem CID 71565669) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(2-fluoro-4-methoxyphenyl)quinoline-2-carboxamide.
| Compound Name | 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(2-fluoro-4-methoxyphenyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71565669 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(2-fluoro-4-methoxyphenyl)quinoline-2-carboxamide |
| SMILES | COc1ccc(-c2cc(C(N)=O)nc3cc(CN4C(=O)CCC4=O)ccc23)c(F)c1 |
| InChI | InChI=1S/C22H18FN3O4/c1-30-13-3-5-14(17(23)9-13)16-10-19(22(24)29)25-18-8-12(2-4-15(16)18)11-26-20(27)6-7-21(26)28/h2-5,8-10H,6-7,11H2,1H3,(H2,24,29) |
| InChIKey | SJTAQJTXNNWMAB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|