C34H32CuO6+2 — CID 71565696
copper bis(1-(3-phenoxyphenyl)pentane-1,3-dione) (PubChem CID 71565696) has the molecular formula C34H32CuO6+2 and a molecular weight of 600.17 g/mol. Its IUPAC name is copper bis(1-(3-phenoxyphenyl)pentane-1,3-dione).
| Compound Name | copper bis(1-(3-phenoxyphenyl)pentane-1,3-dione) |
|---|---|
| PubChem CID | 71565696 |
| Molecular Formula | C34H32CuO6+2 |
| Molecular Weight | 600.17 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | copper bis(1-(3-phenoxyphenyl)pentane-1,3-dione) |
| SMILES | CCC(=O)CC(=O)c1cccc(Oc2ccccc2)c1.CCC(=O)CC(=O)c1cccc(Oc2ccccc2)c1.[Cu+2] |
| InChI | InChI=1S/2C17H16O3.Cu/c2*1-2-14(18)12-17(19)13-7-6-10-16(11-13)20-15-8-4-3-5-9-15;/h2*3-11H,2,12H2,1H3;/q;;+2 |
| InChIKey | OEQZWMMYZMZMJJ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.17 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|