C25H24N4O2 — CID 71566048
7-[1-(2-amino-3-pyridinyl)propan-2-yl]-4-(4-methoxyphenyl)quinoline-2-carboxamide (PubChem CID 71566048) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 7-[1-(2-amino-3-pyridinyl)propan-2-yl]-4-(4-methoxyphenyl)quinoline-2-carboxamide.
| Compound Name | 7-[1-(2-amino-3-pyridinyl)propan-2-yl]-4-(4-methoxyphenyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71566048 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 7-[1-(2-amino-3-pyridinyl)propan-2-yl]-4-(4-methoxyphenyl)quinoline-2-carboxamide |
| SMILES | COc1ccc(-c2cc(C(N)=O)nc3cc(C(C)Cc4cccnc4N)ccc23)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-15(12-18-4-3-11-28-24(18)26)17-7-10-20-21(16-5-8-19(31-2)9-6-16)14-23(25(27)30)29-22(20)13-17/h3-11,13-15H,12H2,1-2H3,(H2,26,28)(H2,27,30) |
| InChIKey | FJCKJZYQYPBUEV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |