C28H28Si — CID 71566789
trimethyl-[6-methyl-5-(4-methylphenyl)-11H-benzo[b]fluoren-10-yl]silane (PubChem CID 71566789) has the molecular formula C28H28Si and a molecular weight of 392.62 g/mol. Its IUPAC name is trimethyl-[6-methyl-5-(4-methylphenyl)-11H-benzo[b]fluoren-10-yl]silane.
| Compound Name | trimethyl-[6-methyl-5-(4-methylphenyl)-11H-benzo[b]fluoren-10-yl]silane |
|---|---|
| PubChem CID | 71566789 |
| Molecular Formula | C28H28Si |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | trimethyl-[6-methyl-5-(4-methylphenyl)-11H-benzo[b]fluoren-10-yl]silane |
| SMILES | Cc1ccc(-c2c3c(c([Si](C)(C)C)c4cccc(C)c24)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C28H28Si/c1-18-13-15-20(16-14-18)26-25-19(2)9-8-12-23(25)28(29(3,4)5)24-17-21-10-6-7-11-22(21)27(24)26/h6-16H,17H2,1-5H3 |
| InChIKey | REUYYGVBSYMMFJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|