C15H15NO3 — CID 71567448
trans-(1S,2S)-2-[2-(3-formylindol-1-yl)ethyl]cyclopropane-1-carboxylic acid (PubChem CID 71567448) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is trans-(1S,2S)-2-[2-(3-formylindol-1-yl)ethyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[2-(3-formylindol-1-yl)ethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 71567448 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | trans-(1S,2S)-2-[2-(3-formylindol-1-yl)ethyl]cyclopropane-1-carboxylic acid |
| SMILES | O=Cc1cn(CC[C@@H]2C[C@@H]2C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C15H15NO3/c17-9-11-8-16(14-4-2-1-3-12(11)14)6-5-10-7-13(10)15(18)19/h1-4,8-10,13H,5-7H2,(H,18,19)/t10-,13+/m1/s1 |
| InChIKey | NDKOZQKEVMCRHU-MFKMUULPSA-N |
| XLogP | 2.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|