C25H21ClN2O3 — CID 71567509
4-[2-[1-(3-chlorophenyl)-5-phenylpyrazol-3-yl]phenoxy]butanoic acid (PubChem CID 71567509) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 4-[2-[1-(3-chlorophenyl)-5-phenylpyrazol-3-yl]phenoxy]butanoic acid.
| Compound Name | 4-[2-[1-(3-chlorophenyl)-5-phenylpyrazol-3-yl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 71567509 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-[2-[1-(3-chlorophenyl)-5-phenylpyrazol-3-yl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccccc1-c1cc(-c2ccccc2)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C25H21ClN2O3/c26-19-10-6-11-20(16-19)28-23(18-8-2-1-3-9-18)17-22(27-28)21-12-4-5-13-24(21)31-15-7-14-25(29)30/h1-6,8-13,16-17H,7,14-15H2,(H,29,30) |
| InChIKey | SHAOOMDOURTRSR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|