C28H27N3O4S3 — CID 71568968
(5Z)-5-[[4-[3-[4-amino-2-(4-methoxyphenyl)sulfonylpiperidin-1-yl]phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71568968) has the molecular formula C28H27N3O4S3 and a molecular weight of 565.74 g/mol. Its IUPAC name is (5Z)-5-[[4-[3-[4-amino-2-(4-methoxyphenyl)sulfonylpiperidin-1-yl]phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[3-[4-amino-2-(4-methoxyphenyl)sulfonylpiperidin-1-yl]phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71568968 |
| Molecular Formula | C28H27N3O4S3 |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | (5Z)-5-[[4-[3-[4-amino-2-(4-methoxyphenyl)sulfonylpiperidin-1-yl]phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(S(=O)(=O)C2CC(N)CCN2c2cccc(-c3ccc(/C=C4\SC(=S)NC4=O)cc3)c2)cc1 |
| InChI | InChI=1S/C28H27N3O4S3/c1-35-23-9-11-24(12-10-23)38(33,34)26-17-21(29)13-14-31(26)22-4-2-3-20(16-22)19-7-5-18(6-8-19)15-25-27(32)30-28(36)37-25/h2-12,15-16,21,26H,13-14,17,29H2,1H3,(H,30,32,36)/b25-15- |
| InChIKey | QMCXAABCIAYMOD-MYYYXRDXSA-N |
| XLogP | 4.58 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|