C13H8BrNO2S2 — CID 71569387
(5Z)-5-[(6-bromo-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71569387) has the molecular formula C13H8BrNO2S2 and a molecular weight of 354.25 g/mol. Its IUPAC name is (5Z)-5-[(6-bromo-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(6-bromo-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71569387 |
| Molecular Formula | C13H8BrNO2S2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 352.92 |
| IUPAC Name | (5Z)-5-[(6-bromo-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\C1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C13H8BrNO2S2/c14-9-1-2-10-8(5-9)3-7(6-17-10)4-11-12(16)15-13(18)19-11/h1-5H,6H2,(H,15,16,18)/b11-4- |
| InChIKey | ORCHEVQYGCNYPP-WCIBSUBMSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|