C25H23ClFN5OS — CID 71571614
(E)-N-[[5-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]thiophen-2-yl]methyl]-4-(dimethylamino)but-2-enamide (PubChem CID 71571614) has the molecular formula C25H23ClFN5OS and a molecular weight of 496.01 g/mol. Its IUPAC name is (E)-N-[[5-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]thiophen-2-yl]methyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[[5-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]thiophen-2-yl]methyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 71571614 |
| Molecular Formula | C25H23ClFN5OS |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (E)-N-[[5-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]thiophen-2-yl]methyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)NCc1ccc(-c2ccc3ncnc(Nc4ccc(F)c(Cl)c4)c3c2)s1 |
| InChI | InChI=1S/C25H23ClFN5OS/c1-32(2)11-3-4-24(33)28-14-18-7-10-23(34-18)16-5-9-22-19(12-16)25(30-15-29-22)31-17-6-8-21(27)20(26)13-17/h3-10,12-13,15H,11,14H2,1-2H3,(H,28,33)(H,29,30,31)/b4-3+ |
| InChIKey | DOUMSJUTGZJHPB-ONEGZZNKSA-N |
| XLogP | 5.63 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|