C19H16BrFN4O3 — CID 71572374
1-(4-bromo-2-fluorophenyl)-3-(2',5'-dioxospiro[2,4-dihydro-1H-naphthalene-3,4'-imidazolidine]-1'-yl)urea (PubChem CID 71572374) has the molecular formula C19H16BrFN4O3 and a molecular weight of 447.26 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(2',5'-dioxospiro[2,4-dihydro-1H-naphthalene-3,4'-imidazolidine]-1'-yl)urea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(2',5'-dioxospiro[2,4-dihydro-1H-naphthalene-3,4'-imidazolidine]-1'-yl)urea |
|---|---|
| PubChem CID | 71572374 |
| Molecular Formula | C19H16BrFN4O3 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(2',5'-dioxospiro[2,4-dihydro-1H-naphthalene-3,4'-imidazolidine]-1'-yl)urea |
| SMILES | O=C(Nc1ccc(Br)cc1F)NN1C(=O)NC2(CCc3ccccc3C2)C1=O |
| InChI | InChI=1S/C19H16BrFN4O3/c20-13-5-6-15(14(21)9-13)22-17(27)24-25-16(26)19(23-18(25)28)8-7-11-3-1-2-4-12(11)10-19/h1-6,9H,7-8,10H2,(H,23,28)(H2,22,24,27) |
| InChIKey | QDVLADUWHPTMIW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|