C18H27NO4 — CID 71573630
cis-(1S,2R)-2-[(2S)-1-hydroxy-2-methyl-4-phenylmethoxybutan-2-yl]-N-methoxy-N-methylcyclopropane-1-carboxamide (PubChem CID 71573630) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(2S)-1-hydroxy-2-methyl-4-phenylmethoxybutan-2-yl]-N-methoxy-N-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-[(2S)-1-hydroxy-2-methyl-4-phenylmethoxybutan-2-yl]-N-methoxy-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71573630 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | cis-(1S,2R)-2-[(2S)-1-hydroxy-2-methyl-4-phenylmethoxybutan-2-yl]-N-methoxy-N-methylcyclopropane-1-carboxamide |
| SMILES | CON(C)C(=O)[C@H]1C[C@H]1[C@@](C)(CO)CCOCc1ccccc1 |
| InChI | InChI=1S/C18H27NO4/c1-18(13-20,16-11-15(16)17(21)19(2)22-3)9-10-23-12-14-7-5-4-6-8-14/h4-8,15-16,20H,9-13H2,1-3H3/t15-,16+,18+/m0/s1 |
| InChIKey | RMVLLNMLNUJYKW-LZLYRXPVSA-N |
| XLogP | 2.25 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|