C21H25NO3S — CID 71573643
N-[(2S)-2-ethenylpent-4-enyl]-N-(2-methoxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 71573643) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is N-[(2S)-2-ethenylpent-4-enyl]-N-(2-methoxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-ethenylpent-4-enyl]-N-(2-methoxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71573643 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[(2S)-2-ethenylpent-4-enyl]-N-(2-methoxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | C=CC[C@@H](C=C)CN(c1ccccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO3S/c1-5-9-18(6-2)16-22(20-10-7-8-11-21(20)25-4)26(23,24)19-14-12-17(3)13-15-19/h5-8,10-15,18H,1-2,9,16H2,3-4H3/t18-/m1/s1 |
| InChIKey | QUTKHPVLSIYVAN-GOSISDBHSA-N |
| XLogP | 4.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|