C18H25N2O4S+ — CID 3431498
[3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium (PubChem CID 3431498) has the molecular formula C18H25N2O4S+ and a molecular weight of 365.48 g/mol. Its IUPAC name is [3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium.
| Compound Name | [3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium |
|---|---|
| PubChem CID | 3431498 |
| Molecular Formula | C18H25N2O4S+ |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | [3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium |
| SMILES | COc1ccccc1N(CC(O)C[NH+](C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-19(2)13-15(21)14-20(17-11-7-8-12-18(17)24-3)25(22,23)16-9-5-4-6-10-16/h4-12,15,21H,13-14H2,1-3H3/p+1 |
| InChIKey | NABFGWBKTOGFEG-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |