C18H25ClN2O4S — CID 44657756
[3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium chloride (PubChem CID 44657756) has the molecular formula C18H25ClN2O4S and a molecular weight of 400.93 g/mol. Its IUPAC name is [3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium chloride.
| Compound Name | [3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 44657756 |
| Molecular Formula | C18H25ClN2O4S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [3-[N-(benzenesulfonyl)-2-methoxyanilino]-2-hydroxypropyl]-dimethylazanium chloride |
| SMILES | COc1ccccc1N(CC(O)C[NH+](C)C)S(=O)(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H24N2O4S.ClH/c1-19(2)13-15(21)14-20(17-11-7-8-12-18(17)24-3)25(22,23)16-9-5-4-6-10-16;/h4-12,15,21H,13-14H2,1-3H3;1H |
| InChIKey | FVZLYIVEOPGMLL-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |