C24H36N2O4S — CID 3715769
N-[3-(dibutylamino)-2-hydroxypropyl]-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 3715769) has the molecular formula C24H36N2O4S and a molecular weight of 448.63 g/mol. Its IUPAC name is N-[3-(dibutylamino)-2-hydroxypropyl]-N-(2-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-[3-(dibutylamino)-2-hydroxypropyl]-N-(2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3715769 |
| Molecular Formula | C24H36N2O4S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[3-(dibutylamino)-2-hydroxypropyl]-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | CCCCN(CCCC)CC(O)CN(c1ccccc1OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H36N2O4S/c1-4-6-17-25(18-7-5-2)19-21(27)20-26(23-15-11-12-16-24(23)30-3)31(28,29)22-13-9-8-10-14-22/h8-16,21,27H,4-7,17-20H2,1-3H3 |
| InChIKey | LHNVWMXOLMTWTK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |