C17H21NO2 — CID 71574118
(2S,4R,5S)-5-methyl-5-(2-phenylmethoxyethyl)-8-oxa-9-azatricyclo[4.3.0.02,4]non-1(9)-ene (PubChem CID 71574118) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (2S,4R,5S)-5-methyl-5-(2-phenylmethoxyethyl)-8-oxa-9-azatricyclo[4.3.0.02,4]non-1(9)-ene.
| Compound Name | (2S,4R,5S)-5-methyl-5-(2-phenylmethoxyethyl)-8-oxa-9-azatricyclo[4.3.0.02,4]non-1(9)-ene |
|---|---|
| PubChem CID | 71574118 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (2S,4R,5S)-5-methyl-5-(2-phenylmethoxyethyl)-8-oxa-9-azatricyclo[4.3.0.02,4]non-1(9)-ene |
| SMILES | C[C@@]1(CCOCc2ccccc2)C2CON=C2[C@H]2C[C@H]21 |
| InChI | InChI=1S/C17H21NO2/c1-17(7-8-19-10-12-5-3-2-4-6-12)14-9-13(14)16-15(17)11-20-18-16/h2-6,13-15H,7-11H2,1H3/t13-,14+,15?,17-/m0/s1 |
| InChIKey | KRUOKILCSMEGNF-MYSGWJLTSA-N |
| XLogP | 3.25 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|