C24H30O6 — CID 71574966
(3R,4R)-3-[(3-butoxy-4-hydroxyphenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]oxolan-2-one (PubChem CID 71574966) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (3R,4R)-3-[(3-butoxy-4-hydroxyphenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]oxolan-2-one.
| Compound Name | (3R,4R)-3-[(3-butoxy-4-hydroxyphenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 71574966 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (3R,4R)-3-[(3-butoxy-4-hydroxyphenyl)methyl]-4-[(3,4-dimethoxyphenyl)methyl]oxolan-2-one |
| SMILES | CCCCOc1cc(C[C@H]2C(=O)OC[C@@H]2Cc2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C24H30O6/c1-4-5-10-29-22-13-17(6-8-20(22)25)12-19-18(15-30-24(19)26)11-16-7-9-21(27-2)23(14-16)28-3/h6-9,13-14,18-19,25H,4-5,10-12,15H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | CDEQBQBLYAVJJW-RBUKOAKNSA-N |
| XLogP | 4.16 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|