C29H39O8- — CID 131742260
(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one;octanoate (PubChem CID 131742260) has the molecular formula C29H39O8- and a molecular weight of 515.62 g/mol. Its IUPAC name is (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one;octanoate.
| Compound Name | (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one;octanoate |
|---|---|
| PubChem CID | 131742260 |
| Molecular Formula | C29H39O8- |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one;octanoate |
| SMILES | CCCCCCCC(=O)[O-].COc1cc(C[C@H]2C(=O)OC[C@@H]2Cc2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H24O6.C8H16O2/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2;1-2-3-4-5-6-7-8(9)10/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3;2-7H2,1H3,(H,9,10)/p-1/t15-,16+;/m0./s1 |
| InChIKey | DDTUZMDOOVSQEG-IDVLALEDSA-M |
| XLogP | 4.09 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|