C29H40O8S — CID 10792726
[4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] octane-1-sulfonate (PubChem CID 10792726) has the molecular formula C29H40O8S and a molecular weight of 548.70 g/mol. Its IUPAC name is [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] octane-1-sulfonate.
| Compound Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] octane-1-sulfonate |
|---|---|
| PubChem CID | 10792726 |
| Molecular Formula | C29H40O8S |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)Oc1ccc(C[C@H]2C(=O)OC[C@@H]2Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C29H40O8S/c1-5-6-7-8-9-10-15-38(31,32)37-26-14-12-22(19-28(26)35-4)17-24-23(20-36-29(24)30)16-21-11-13-25(33-2)27(18-21)34-3/h11-14,18-19,23-24H,5-10,15-17,20H2,1-4H3/t23-,24+/m0/s1 |
| InChIKey | LQVCFPGVNVEJDR-BJKOFHAPSA-N |
| XLogP | 5.36 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|