C16H8BrClN4O3 — CID 71576083
N-(3-bromophenyl)-2-chloro-8-nitro-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 71576083) has the molecular formula C16H8BrClN4O3 and a molecular weight of 419.62 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-chloro-8-nitro-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3-bromophenyl)-2-chloro-8-nitro-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71576083 |
| Molecular Formula | C16H8BrClN4O3 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | N-(3-bromophenyl)-2-chloro-8-nitro-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1ccc2oc3c(Nc4cccc(Br)c4)nc(Cl)nc3c2c1 |
| InChI | InChI=1S/C16H8BrClN4O3/c17-8-2-1-3-9(6-8)19-15-14-13(20-16(18)21-15)11-7-10(22(23)24)4-5-12(11)25-14/h1-7H,(H,19,20,21) |
| InChIKey | RMRWKOUTSYQTCK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|