C25H39N3O5SSi — CID 71578864
(2R,3aS,4S,6R,7aS)-2-(azidomethyl)-3a-(benzenesulfonyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-ol (PubChem CID 71578864) has the molecular formula C25H39N3O5SSi and a molecular weight of 521.76 g/mol. Its IUPAC name is (2R,3aS,4S,6R,7aS)-2-(azidomethyl)-3a-(benzenesulfonyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-ol.
| Compound Name | (2R,3aS,4S,6R,7aS)-2-(azidomethyl)-3a-(benzenesulfonyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-ol |
|---|---|
| PubChem CID | 71578864 |
| Molecular Formula | C25H39N3O5SSi |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (2R,3aS,4S,6R,7aS)-2-(azidomethyl)-3a-(benzenesulfonyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-7a-ol |
| SMILES | C=C(C[C@@H]1C[C@@H](C)C[C@]2(O)O[C@@H](CN=[N+]=[N-])C[C@]12S(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39N3O5SSi/c1-18-13-20(14-19(2)33-35(6,7)23(3,4)5)24(34(30,31)22-11-9-8-10-12-22)16-21(17-27-28-26)32-25(24,29)15-18/h8-12,18,20-21,29H,2,13-17H2,1,3-7H3/t18-,20+,21-,24+,25+/m1/s1 |
| InChIKey | RXHOJXHOPXRTIN-WPQWVOAUSA-N |
| XLogP | 5.96 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|