C19H25N3O5S — CID 135034223
1-[(2R)-2-(azidomethyl)-3a-(benzenesulfonyl)-7a-hydroxy-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one (PubChem CID 135034223) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 1-[(2R)-2-(azidomethyl)-3a-(benzenesulfonyl)-7a-hydroxy-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one.
| Compound Name | 1-[(2R)-2-(azidomethyl)-3a-(benzenesulfonyl)-7a-hydroxy-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one |
|---|---|
| PubChem CID | 135034223 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-[(2R)-2-(azidomethyl)-3a-(benzenesulfonyl)-7a-hydroxy-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one |
| SMILES | CC(=O)CC1CC(C)CC2(O)O[C@@H](CN=[N+]=[N-])CC12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O5S/c1-13-8-15(9-14(2)23)18(28(25,26)17-6-4-3-5-7-17)11-16(12-21-22-20)27-19(18,24)10-13/h3-7,13,15-16,24H,8-12H2,1-2H3/t13?,15?,16-,18?,19?/m1/s1 |
| InChIKey | RGZJBHJCCZLFAS-LLRVDCFISA-N |
| XLogP | 3.01 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|