C19H26O6S — CID 135033912
1-[(2R)-3a-(benzenesulfonyl)-7a-hydroxy-2-(hydroxymethyl)-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one (PubChem CID 135033912) has the molecular formula C19H26O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-[(2R)-3a-(benzenesulfonyl)-7a-hydroxy-2-(hydroxymethyl)-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one.
| Compound Name | 1-[(2R)-3a-(benzenesulfonyl)-7a-hydroxy-2-(hydroxymethyl)-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one |
|---|---|
| PubChem CID | 135033912 |
| Molecular Formula | C19H26O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[(2R)-3a-(benzenesulfonyl)-7a-hydroxy-2-(hydroxymethyl)-6-methyl-2,3,4,5,6,7-hexahydro-1-benzofuran-4-yl]propan-2-one |
| SMILES | CC(=O)CC1CC(C)CC2(O)O[C@@H](CO)CC12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26O6S/c1-13-8-15(9-14(2)21)18(11-16(12-20)25-19(18,22)10-13)26(23,24)17-6-4-3-5-7-17/h3-7,13,15-16,20,22H,8-12H2,1-2H3/t13?,15?,16-,18?,19?/m1/s1 |
| InChIKey | UXIUNUZXCYMOHP-LLRVDCFISA-N |
| XLogP | 1.69 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |