C27H40O7S — CID 134981921
methyl (1S,2R,5S)-5-[2-(benzenesulfonyl)-1-hydroxy-3-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propyl]-2-ethenyl-2-methylcyclohexane-1-carboxylate (PubChem CID 134981921) has the molecular formula C27H40O7S and a molecular weight of 508.68 g/mol. Its IUPAC name is methyl (1S,2R,5S)-5-[2-(benzenesulfonyl)-1-hydroxy-3-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propyl]-2-ethenyl-2-methylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2R,5S)-5-[2-(benzenesulfonyl)-1-hydroxy-3-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propyl]-2-ethenyl-2-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134981921 |
| Molecular Formula | C27H40O7S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | methyl (1S,2R,5S)-5-[2-(benzenesulfonyl)-1-hydroxy-3-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propyl]-2-ethenyl-2-methylcyclohexane-1-carboxylate |
| SMILES | C=C[C@@]1(C)CC[C@H](C(O)C(C[C@H]2OC(C)(C)OC2(C)C)S(=O)(=O)c2ccccc2)C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C27H40O7S/c1-8-27(6)15-14-18(16-20(27)24(29)32-7)23(28)21(35(30,31)19-12-10-9-11-13-19)17-22-25(2,3)34-26(4,5)33-22/h8-13,18,20-23,28H,1,14-17H2,2-7H3/t18-,20+,21?,22+,23?,27-/m0/s1 |
| InChIKey | MJROEBWCXNPNKQ-KENFTEENSA-N |
| XLogP | 4.29 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|