C31H48O9S — CID 175257932
propyl 3-[(2S,4R,6R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]-2,2-dimethylpropanoate (PubChem CID 175257932) has the molecular formula C31H48O9S and a molecular weight of 596.78 g/mol. Its IUPAC name is propyl 3-[(2S,4R,6R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]-2,2-dimethylpropanoate.
| Compound Name | propyl 3-[(2S,4R,6R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175257932 |
| Molecular Formula | C31H48O9S |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | propyl 3-[(2S,4R,6R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]-2,2-dimethylpropanoate |
| SMILES | C=C1[C@H](C)C[C@@H](CC(C)(C)C(=O)OCCC)O[C@@H]1C[C@@H]1O[C@H](CC(O)CO)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H48O9S/c1-7-13-38-30(34)31(4,5)17-23-14-20(2)21(3)26(39-23)16-27-25(19-41(35,36)24-11-9-8-10-12-24)29(37-6)28(40-27)15-22(33)18-32/h8-12,20,22-23,25-29,32-33H,3,7,13-19H2,1-2,4-6H3/t20-,22?,23+,25+,26-,27+,28-,29-/m1/s1 |
| InChIKey | YDQGJVVEERXKEP-QFGDFRLNSA-N |
| XLogP | 3.71 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|