C23H34O9S — CID 11027322
[(2S,3S,4E,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-4-(2-hydroxyethylidene)oxan-3-yl] acetate (PubChem CID 11027322) has the molecular formula C23H34O9S and a molecular weight of 486.58 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-4-(2-hydroxyethylidene)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4E,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-4-(2-hydroxyethylidene)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11027322 |
| Molecular Formula | C23H34O9S |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [(2S,3S,4E,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-dihydroxybutyl]-2-hydroxy-4-(2-hydroxyethylidene)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C(=C/CO)C[C@@H](C[C@@H](O)[C@@H](C)O)O[C@@]1(O)C(C)(C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H34O9S/c1-15(25)20(27)13-18-12-17(10-11-24)21(31-16(2)26)23(28,32-18)22(3,4)14-33(29,30)19-8-6-5-7-9-19/h5-10,15,18,20-21,24-25,27-28H,11-14H2,1-4H3/b17-10+/t15-,18+,20-,21+,23-/m1/s1 |
| InChIKey | CJKPDVLMTVEJQO-YGBVUKQGSA-N |
| XLogP | 0.95 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|