C23H36O6S — CID 11059253
(4R)-4-[(1S,2S,3R,6R)-2-(benzenesulfonylmethyl)-6-(methoxymethoxymethyl)-2,3-dimethylcyclohexyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11059253) has the molecular formula C23H36O6S and a molecular weight of 440.60 g/mol. Its IUPAC name is (4R)-4-[(1S,2S,3R,6R)-2-(benzenesulfonylmethyl)-6-(methoxymethoxymethyl)-2,3-dimethylcyclohexyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(1S,2S,3R,6R)-2-(benzenesulfonylmethyl)-6-(methoxymethoxymethyl)-2,3-dimethylcyclohexyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11059253 |
| Molecular Formula | C23H36O6S |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (4R)-4-[(1S,2S,3R,6R)-2-(benzenesulfonylmethyl)-6-(methoxymethoxymethyl)-2,3-dimethylcyclohexyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | COCOC[C@@H]1CC[C@@H](C)[C@](C)(CS(=O)(=O)c2ccccc2)[C@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H36O6S/c1-17-11-12-18(13-27-16-26-5)21(20-14-28-22(2,3)29-20)23(17,4)15-30(24,25)19-9-7-6-8-10-19/h6-10,17-18,20-21H,11-16H2,1-5H3/t17-,18+,20+,21-,23+/m1/s1 |
| InChIKey | HZYLEFBCKUDGGJ-JQXAWIDASA-N |
| XLogP | 3.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|