C26H30ClN3O — CID 71579957
N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylbutanamide;hydrochloride (PubChem CID 71579957) has the molecular formula C26H30ClN3O and a molecular weight of 436.00 g/mol. Its IUPAC name is N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylbutanamide;hydrochloride.
| Compound Name | N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 71579957 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylbutanamide;hydrochloride |
| SMILES | CCCC(=O)N(CC(C)/C(=N\c1ccccc1)Nc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C26H29N3O.ClH/c1-3-13-25(30)29(24-18-11-6-12-19-24)20-21(2)26(27-22-14-7-4-8-15-22)28-23-16-9-5-10-17-23;/h4-12,14-19,21H,3,13,20H2,1-2H3,(H,27,28);1H |
| InChIKey | YVEVDGQPEWBPLX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|