C31H39ClN3O- — CID 71737860
N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylnonanamide chloride (PubChem CID 71737860) has the molecular formula C31H39ClN3O- and a molecular weight of 505.13 g/mol. Its IUPAC name is N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylnonanamide chloride.
| Compound Name | N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylnonanamide chloride |
|---|---|
| PubChem CID | 71737860 |
| Molecular Formula | C31H39ClN3O- |
| Molecular Weight | 505.13 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | N-(3-anilino-2-methyl-3-phenyliminopropyl)-N-phenylnonanamide chloride |
| SMILES | CCCCCCCCC(=O)N(CC(C)/C(=N\c1ccccc1)Nc1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C31H39N3O.ClH/c1-3-4-5-6-7-17-24-30(35)34(29-22-15-10-16-23-29)25-26(2)31(32-27-18-11-8-12-19-27)33-28-20-13-9-14-21-28;/h8-16,18-23,26H,3-7,17,24-25H2,1-2H3,(H,32,33);1H/p-1 |
| InChIKey | QWJKGEWTARVJGI-UHFFFAOYSA-M |
| XLogP | 5.25 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.13 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|