C23H30N2O3S — CID 7158100
(1R)-6,7-dimethoxy-N-methyl-1-[(4-propan-2-ylphenoxy)methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 7158100) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (1R)-6,7-dimethoxy-N-methyl-1-[(4-propan-2-ylphenoxy)methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (1R)-6,7-dimethoxy-N-methyl-1-[(4-propan-2-ylphenoxy)methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 7158100 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (1R)-6,7-dimethoxy-N-methyl-1-[(4-propan-2-ylphenoxy)methyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CNC(=S)N1CCc2cc(OC)c(OC)cc2[C@@H]1COc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-15(2)16-6-8-18(9-7-16)28-14-20-19-13-22(27-5)21(26-4)12-17(19)10-11-25(20)23(29)24-3/h6-9,12-13,15,20H,10-11,14H2,1-5H3,(H,24,29)/t20-/m0/s1 |
| InChIKey | ZDULWQNEYBHIFS-FQEVSTJZSA-N |
| XLogP | 4.31 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|