C24H24ClF3N4O3 — CID 71582294
2-[[1-(4-chlorobenzoyl)azetidin-3-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide (PubChem CID 71582294) has the molecular formula C24H24ClF3N4O3 and a molecular weight of 508.93 g/mol. Its IUPAC name is 2-[[1-(4-chlorobenzoyl)azetidin-3-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide.
| Compound Name | 2-[[1-(4-chlorobenzoyl)azetidin-3-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 71582294 |
| Molecular Formula | C24H24ClF3N4O3 |
| Molecular Weight | 508.93 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-[[1-(4-chlorobenzoyl)azetidin-3-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide |
| SMILES | Cc1c(C(=O)NCCOCC(F)(F)F)ccc2nn(CC3CN(C(=O)c4ccc(Cl)cc4)C3)cc12 |
| InChI | InChI=1S/C24H24ClF3N4O3/c1-15-19(22(33)29-8-9-35-14-24(26,27)28)6-7-21-20(15)13-32(30-21)12-16-10-31(11-16)23(34)17-2-4-18(25)5-3-17/h2-7,13,16H,8-12,14H2,1H3,(H,29,33) |
| InChIKey | CFFSTVIZZFRKTI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.93 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|