C35H42N4O4 — CID 71581596
2-[[1-[4-(4-tert-butylphenoxy)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide (PubChem CID 71581596) has the molecular formula C35H42N4O4 and a molecular weight of 582.75 g/mol. Its IUPAC name is 2-[[1-[4-(4-tert-butylphenoxy)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide.
| Compound Name | 2-[[1-[4-(4-tert-butylphenoxy)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide |
|---|---|
| PubChem CID | 71581596 |
| Molecular Formula | C35H42N4O4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 2-[[1-[4-(4-tert-butylphenoxy)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide |
| SMILES | COCCNC(=O)c1ccc2nn(CC3CCN(C(=O)c4ccc(Oc5ccc(C(C)(C)C)cc5)cc4)CC3)cc2c1C |
| InChI | InChI=1S/C35H42N4O4/c1-24-30(33(40)36-18-21-42-5)14-15-32-31(24)23-39(37-32)22-25-16-19-38(20-17-25)34(41)26-6-10-28(11-7-26)43-29-12-8-27(9-13-29)35(2,3)4/h6-15,23,25H,16-22H2,1-5H3,(H,36,40) |
| InChIKey | WMPZVKJAXFEXMT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|