C29H35N3O3 — CID 160980692
1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one (PubChem CID 160980692) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 160980692 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1ccc2nn(CC3CCN(C(=O)c4ccc(C5CC5)cc4)CC3)cc2c1C |
| InChI | InChI=1S/C29H35N3O3/c1-20-25(28(33)4-3-17-35-2)11-12-27-26(20)19-32(30-27)18-21-13-15-31(16-14-21)29(34)24-9-7-23(8-10-24)22-5-6-22/h7-12,19,21-22H,3-6,13-18H2,1-2H3 |
| InChIKey | SZLXUIQMXKTXBE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|