C19H28ClN3O2 — CID 159556667
4-methoxy-1-[4-methyl-2-(piperidin-4-ylmethyl)indazol-5-yl]butan-1-one;hydrochloride (PubChem CID 159556667) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is 4-methoxy-1-[4-methyl-2-(piperidin-4-ylmethyl)indazol-5-yl]butan-1-one;hydrochloride.
| Compound Name | 4-methoxy-1-[4-methyl-2-(piperidin-4-ylmethyl)indazol-5-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 159556667 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-methoxy-1-[4-methyl-2-(piperidin-4-ylmethyl)indazol-5-yl]butan-1-one;hydrochloride |
| SMILES | COCCCC(=O)c1ccc2nn(CC3CCNCC3)cc2c1C.Cl |
| InChI | InChI=1S/C19H27N3O2.ClH/c1-14-16(19(23)4-3-11-24-2)5-6-18-17(14)13-22(21-18)12-15-7-9-20-10-8-15;/h5-6,13,15,20H,3-4,7-12H2,1-2H3;1H |
| InChIKey | ZKTATJVNWHQPLQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|