C30H34F3N3O3 — CID 149135934
1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-(2,2,2-trifluoroethoxy)butan-1-one (PubChem CID 149135934) has the molecular formula C30H34F3N3O3 and a molecular weight of 541.61 g/mol. Its IUPAC name is 1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-(2,2,2-trifluoroethoxy)butan-1-one.
| Compound Name | 1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-(2,2,2-trifluoroethoxy)butan-1-one |
|---|---|
| PubChem CID | 149135934 |
| Molecular Formula | C30H34F3N3O3 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 1-[2-[[1-(4-cyclopropylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-(2,2,2-trifluoroethoxy)butan-1-one |
| SMILES | Cc1c(C(=O)CCCOCC(F)(F)F)ccc2nn(CC3CCN(C(=O)c4ccc(C5CC5)cc4)CC3)cc12 |
| InChI | InChI=1S/C30H34F3N3O3/c1-20-25(28(37)3-2-16-39-19-30(31,32)33)10-11-27-26(20)18-36(34-27)17-21-12-14-35(15-13-21)29(38)24-8-6-23(7-9-24)22-4-5-22/h6-11,18,21-22H,2-5,12-17,19H2,1H3 |
| InChIKey | REJACRBSEGMSNG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|