C32H34FN3O3 — CID 147241210
1-[2-[[1-(3-fluoro-4-phenylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one (PubChem CID 147241210) has the molecular formula C32H34FN3O3 and a molecular weight of 527.64 g/mol. Its IUPAC name is 1-[2-[[1-(3-fluoro-4-phenylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[2-[[1-(3-fluoro-4-phenylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 147241210 |
| Molecular Formula | C32H34FN3O3 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 1-[2-[[1-(3-fluoro-4-phenylbenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1ccc2nn(CC3CCN(C(=O)c4ccc(-c5ccccc5)c(F)c4)CC3)cc2c1C |
| InChI | InChI=1S/C32H34FN3O3/c1-22-26(31(37)9-6-18-39-2)12-13-30-28(22)21-36(34-30)20-23-14-16-35(17-15-23)32(38)25-10-11-27(29(33)19-25)24-7-4-3-5-8-24/h3-5,7-8,10-13,19,21,23H,6,9,14-18,20H2,1-2H3 |
| InChIKey | CKUSMLCWBUHHAD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|