C30H38N4O4 — CID 162125914
4-methoxy-1-[4-methyl-2-[[1-(4-morpholin-4-ylbenzoyl)piperidin-4-yl]methyl]indazol-5-yl]butan-1-one (PubChem CID 162125914) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-methoxy-1-[4-methyl-2-[[1-(4-morpholin-4-ylbenzoyl)piperidin-4-yl]methyl]indazol-5-yl]butan-1-one.
| Compound Name | 4-methoxy-1-[4-methyl-2-[[1-(4-morpholin-4-ylbenzoyl)piperidin-4-yl]methyl]indazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 162125914 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 4-methoxy-1-[4-methyl-2-[[1-(4-morpholin-4-ylbenzoyl)piperidin-4-yl]methyl]indazol-5-yl]butan-1-one |
| SMILES | COCCCC(=O)c1ccc2nn(CC3CCN(C(=O)c4ccc(N5CCOCC5)cc4)CC3)cc2c1C |
| InChI | InChI=1S/C30H38N4O4/c1-22-26(29(35)4-3-17-37-2)9-10-28-27(22)21-34(31-28)20-23-11-13-33(14-12-23)30(36)24-5-7-25(8-6-24)32-15-18-38-19-16-32/h5-10,21,23H,3-4,11-20H2,1-2H3 |
| InChIKey | ZIAGCSOWRAIIJO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|