C26H29BrFN3O3 — CID 149202889
1-[2-[[1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one (PubChem CID 149202889) has the molecular formula C26H29BrFN3O3 and a molecular weight of 530.44 g/mol. Its IUPAC name is 1-[2-[[1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[2-[[1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 149202889 |
| Molecular Formula | C26H29BrFN3O3 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-[2-[[1-(4-bromo-2-fluorobenzoyl)piperidin-4-yl]methyl]-4-methylindazol-5-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1ccc2nn(CC3CCN(C(=O)c4ccc(Br)cc4F)CC3)cc2c1C |
| InChI | InChI=1S/C26H29BrFN3O3/c1-17-20(25(32)4-3-13-34-2)7-8-24-22(17)16-31(29-24)15-18-9-11-30(12-10-18)26(33)21-6-5-19(27)14-23(21)28/h5-8,14,16,18H,3-4,9-13,15H2,1-2H3 |
| InChIKey | XFAUVJWLICITJJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|