C25H35F2N3O4 — CID 162170969
1-[4-[[4-(difluoromethoxy)-5-(4-methoxybutanoyl)indazol-2-yl]methyl]piperidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 162170969) has the molecular formula C25H35F2N3O4 and a molecular weight of 479.57 g/mol. Its IUPAC name is 1-[4-[[4-(difluoromethoxy)-5-(4-methoxybutanoyl)indazol-2-yl]methyl]piperidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-[[4-(difluoromethoxy)-5-(4-methoxybutanoyl)indazol-2-yl]methyl]piperidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 162170969 |
| Molecular Formula | C25H35F2N3O4 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 1-[4-[[4-(difluoromethoxy)-5-(4-methoxybutanoyl)indazol-2-yl]methyl]piperidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | COCCCC(=O)c1ccc2nn(CC3CCN(C(=O)CC(C)(C)C)CC3)cc2c1OC(F)F |
| InChI | InChI=1S/C25H35F2N3O4/c1-25(2,3)14-22(32)29-11-9-17(10-12-29)15-30-16-19-20(28-30)8-7-18(23(19)34-24(26)27)21(31)6-5-13-33-4/h7-8,16-17,24H,5-6,9-15H2,1-4H3 |
| InChIKey | ZNTZDIFHTSEUFS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|