C32H32F3N3O4 — CID 159622719
4-methoxy-1-[4-methyl-2-[[(3S)-1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]pyrrolidin-3-yl]methyl]indazol-5-yl]butan-1-one (PubChem CID 159622719) has the molecular formula C32H32F3N3O4 and a molecular weight of 579.62 g/mol. Its IUPAC name is 4-methoxy-1-[4-methyl-2-[[(3S)-1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]pyrrolidin-3-yl]methyl]indazol-5-yl]butan-1-one.
| Compound Name | 4-methoxy-1-[4-methyl-2-[[(3S)-1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]pyrrolidin-3-yl]methyl]indazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 159622719 |
| Molecular Formula | C32H32F3N3O4 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 4-methoxy-1-[4-methyl-2-[[(3S)-1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]pyrrolidin-3-yl]methyl]indazol-5-yl]butan-1-one |
| SMILES | COCCCC(=O)c1ccc2nn(C[C@H]3CCN(C(=O)c4ccc(Oc5ccc(C(F)(F)F)cc5)cc4)C3)cc2c1C |
| InChI | InChI=1S/C32H32F3N3O4/c1-21-27(30(39)4-3-17-41-2)13-14-29-28(21)20-38(36-29)19-22-15-16-37(18-22)31(40)23-5-9-25(10-6-23)42-26-11-7-24(8-12-26)32(33,34)35/h5-14,20,22H,3-4,15-19H2,1-2H3/t22-/m0/s1 |
| InChIKey | MOCBKDRLXJVEBE-QFIPXVFZSA-N |
| XLogP | 6.93 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|