C31H30F3N3O4 — CID 149222533
4-methoxy-1-[6-methyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]azetidin-3-yl]methyl]indazol-5-yl]butan-1-one (PubChem CID 149222533) has the molecular formula C31H30F3N3O4 and a molecular weight of 565.59 g/mol. Its IUPAC name is 4-methoxy-1-[6-methyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]azetidin-3-yl]methyl]indazol-5-yl]butan-1-one.
| Compound Name | 4-methoxy-1-[6-methyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]azetidin-3-yl]methyl]indazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 149222533 |
| Molecular Formula | C31H30F3N3O4 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 4-methoxy-1-[6-methyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]azetidin-3-yl]methyl]indazol-5-yl]butan-1-one |
| SMILES | COCCCC(=O)c1cc2cn(CC3CN(C(=O)c4ccc(Oc5ccc(C(F)(F)F)cc5)cc4)C3)nc2cc1C |
| InChI | InChI=1S/C31H30F3N3O4/c1-20-14-28-23(15-27(20)29(38)4-3-13-40-2)19-37(35-28)18-21-16-36(17-21)30(39)22-5-9-25(10-6-22)41-26-11-7-24(8-12-26)31(32,33)34/h5-12,14-15,19,21H,3-4,13,16-18H2,1-2H3 |
| InChIKey | XISOCJPQKHUBNJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|