C34H37F3N4O3 — CID 150691537
4-methyl-N-pentyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]piperidin-4-yl]methyl]indazole-5-carboxamide (PubChem CID 150691537) has the molecular formula C34H37F3N4O3 and a molecular weight of 606.69 g/mol. Its IUPAC name is 4-methyl-N-pentyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]piperidin-4-yl]methyl]indazole-5-carboxamide.
| Compound Name | 4-methyl-N-pentyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]piperidin-4-yl]methyl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 150691537 |
| Molecular Formula | C34H37F3N4O3 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 4-methyl-N-pentyl-2-[[1-[4-[4-(trifluoromethyl)phenoxy]benzoyl]piperidin-4-yl]methyl]indazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc2nn(CC3CCN(C(=O)c4ccc(Oc5ccc(C(F)(F)F)cc5)cc4)CC3)cc2c1C |
| InChI | InChI=1S/C34H37F3N4O3/c1-3-4-5-18-38-32(42)29-14-15-31-30(23(29)2)22-41(39-31)21-24-16-19-40(20-17-24)33(43)25-6-10-27(11-7-25)44-28-12-8-26(9-13-28)34(35,36)37/h6-15,22,24H,3-5,16-21H2,1-2H3,(H,38,42) |
| InChIKey | JJZDWJRTYBGRFT-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|