C19H27ClN4O2 — CID 141455120
2-(azetidin-3-ylmethyl)-N-(2-cyclobutyloxyethyl)-4-methylindazole-5-carboxamide;hydrochloride (PubChem CID 141455120) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethyl)-N-(2-cyclobutyloxyethyl)-4-methylindazole-5-carboxamide;hydrochloride.
| Compound Name | 2-(azetidin-3-ylmethyl)-N-(2-cyclobutyloxyethyl)-4-methylindazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 141455120 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-(azetidin-3-ylmethyl)-N-(2-cyclobutyloxyethyl)-4-methylindazole-5-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NCCOC2CCC2)ccc2nn(CC3CNC3)cc12.Cl |
| InChI | InChI=1S/C19H26N4O2.ClH/c1-13-16(19(24)21-7-8-25-15-3-2-4-15)5-6-18-17(13)12-23(22-18)11-14-9-20-10-14;/h5-6,12,14-15,20H,2-4,7-11H2,1H3,(H,21,24);1H |
| InChIKey | MZJSMTGAZQUWLJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|