C16H21N5O — CID 71582959
2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-methylpyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 71582959) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-methylpyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-methylpyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 71582959 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-5-methylpyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2ccn(C)c2c1=O |
| InChI | InChI=1S/C16H21N5O/c1-3-4-9-21-15(22)14-13(7-10-19(14)2)18-16(21)20-8-5-6-12(17)11-20/h7,10,12H,5-6,8-9,11,17H2,1-2H3/t12-/m1/s1 |
| InChIKey | NVPKGVQJGWHMQP-GFCCVEGCSA-N |
| XLogP | 0.69 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|