C9H11N3O2 — CID 3043224
1,3,5-trimethylpyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 3043224) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1,3,5-trimethylpyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 1,3,5-trimethylpyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3043224 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1,3,5-trimethylpyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(ccn2C)n(C)c1=O |
| InChI | InChI=1S/C9H11N3O2/c1-10-5-4-6-7(10)8(13)12(3)9(14)11(6)2/h4-5H,1-3H3 |
| InChIKey | VJEONQKOZGKCAK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |