C13H19N3O2 — CID 10264078
5-methyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 10264078) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-methyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10264078 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 5-methyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCCn1c(=O)c2c(ccn2C)n(CCC)c1=O |
| InChI | InChI=1S/C13H19N3O2/c1-4-7-15-10-6-9-14(3)11(10)12(17)16(8-5-2)13(15)18/h6,9H,4-5,7-8H2,1-3H3 |
| InChIKey | ZXMNPTLAGMLPFI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |