C15H14N4O2S — CID 71583505
1-(1,2,3-benzothiadiazol-6-yl)-3-(2-hydroxy-2-phenylethyl)urea (PubChem CID 71583505) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-6-yl)-3-(2-hydroxy-2-phenylethyl)urea.
| Compound Name | 1-(1,2,3-benzothiadiazol-6-yl)-3-(2-hydroxy-2-phenylethyl)urea |
|---|---|
| PubChem CID | 71583505 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-6-yl)-3-(2-hydroxy-2-phenylethyl)urea |
| SMILES | O=C(NCC(O)c1ccccc1)Nc1ccc2nnsc2c1 |
| InChI | InChI=1S/C15H14N4O2S/c20-13(10-4-2-1-3-5-10)9-16-15(21)17-11-6-7-12-14(8-11)22-19-18-12/h1-8,13,20H,9H2,(H2,16,17,21) |
| InChIKey | NNNVEMUGVAIONS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |