C13H14N2O2S — CID 2812623
1-(2-hydroxy-2-phenylethyl)-3-thiophen-2-ylurea (PubChem CID 2812623) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-(2-hydroxy-2-phenylethyl)-3-thiophen-2-ylurea.
| Compound Name | 1-(2-hydroxy-2-phenylethyl)-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 2812623 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(2-hydroxy-2-phenylethyl)-3-thiophen-2-ylurea |
| SMILES | O=C(NCC(O)c1ccccc1)Nc1cccs1 |
| InChI | InChI=1S/C13H14N2O2S/c16-11(10-5-2-1-3-6-10)9-14-13(17)15-12-7-4-8-18-12/h1-8,11,16H,9H2,(H2,14,15,17) |
| InChIKey | UQUUSGXIFCPNHR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |