C12H14N2O3S — CID 71804496
1-[3-(furan-3-yl)-3-hydroxypropyl]-3-thiophen-2-ylurea (PubChem CID 71804496) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-[3-(furan-3-yl)-3-hydroxypropyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[3-(furan-3-yl)-3-hydroxypropyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 71804496 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-[3-(furan-3-yl)-3-hydroxypropyl]-3-thiophen-2-ylurea |
| SMILES | O=C(NCCC(O)c1ccoc1)Nc1cccs1 |
| InChI | InChI=1S/C12H14N2O3S/c15-10(9-4-6-17-8-9)3-5-13-12(16)14-11-2-1-7-18-11/h1-2,4,6-8,10,15H,3,5H2,(H2,13,14,16) |
| InChIKey | VRIWMSAGGVOOSD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |