C26H23F2N5O — CID 71585518
1-(7-amino-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-1-yl]ethanone (PubChem CID 71585518) has the molecular formula C26H23F2N5O and a molecular weight of 459.50 g/mol. Its IUPAC name is 1-(7-amino-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-1-yl]ethanone.
| Compound Name | 1-(7-amino-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-1-yl]ethanone |
|---|---|
| PubChem CID | 71585518 |
| Molecular Formula | C26H23F2N5O |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 1-(7-amino-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-1-yl]ethanone |
| SMILES | Nc1ccc2c(c1)CCN(C(=O)Cn1nc(-c3ccc(F)cc3)nc1-c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C26H23F2N5O/c27-21-6-1-18(2-7-21)25-30-26(19-3-8-22(28)9-4-19)33(31-25)16-24(34)32-13-11-17-5-10-23(29)15-20(17)12-14-32/h1-10,15H,11-14,16,29H2 |
| InChIKey | RVUZRVAPCIGRGG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|